C22H22N4O2 — CID 4125132
N-(2,2-dimethoxyethyl)-5,7-diphenylpyrrolo[2,3-d]pyrimidin-4-amine (PubChem CID 4125132) has the molecular formula C22H22N4O2 and a molecular weight of 374.44 g/mol. Its IUPAC name is N-(2,2-dimethoxyethyl)-5,7-diphenylpyrrolo[2,3-d]pyrimidin-4-amine.
| Compound Name | N-(2,2-dimethoxyethyl)-5,7-diphenylpyrrolo[2,3-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 4125132 |
| Molecular Formula | C22H22N4O2 |
| Molecular Weight | 374.44 g/mol |
| Exact Mass | 374.17 |
| IUPAC Name | N-(2,2-dimethoxyethyl)-5,7-diphenylpyrrolo[2,3-d]pyrimidin-4-amine |
| SMILES | COC(CNc1ncnc2c1c(-c1ccccc1)cn2-c1ccccc1)OC |
| InChI | InChI=1S/C22H22N4O2/c1-27-19(28-2)13-23-21-20-18(16-9-5-3-6-10-16)14-26(22(20)25-15-24-21)17-11-7-4-8-12-17/h3-12,14-15,19H,13H2,1-2H3,(H,23,24,25) |
| InChIKey | ABUKXRNQIBAPPY-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 61.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.44 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|