C23H24N4O3 — CID 4207963
2-[2-[[7-(4-methoxyphenyl)-5-phenylpyrrolo[2,3-d]pyrimidin-4-yl]amino]ethoxy]ethanol (PubChem CID 4207963) has the molecular formula C23H24N4O3 and a molecular weight of 404.47 g/mol. Its IUPAC name is 2-[2-[[7-(4-methoxyphenyl)-5-phenylpyrrolo[2,3-d]pyrimidin-4-yl]amino]ethoxy]ethanol.
| Compound Name | 2-[2-[[7-(4-methoxyphenyl)-5-phenylpyrrolo[2,3-d]pyrimidin-4-yl]amino]ethoxy]ethanol |
|---|---|
| PubChem CID | 4207963 |
| Molecular Formula | C23H24N4O3 |
| Molecular Weight | 404.47 g/mol |
| Exact Mass | 404.18 |
| IUPAC Name | 2-[2-[[7-(4-methoxyphenyl)-5-phenylpyrrolo[2,3-d]pyrimidin-4-yl]amino]ethoxy]ethanol |
| SMILES | COc1ccc(-n2cc(-c3ccccc3)c3c(NCCOCCO)ncnc32)cc1 |
| InChI | InChI=1S/C23H24N4O3/c1-29-19-9-7-18(8-10-19)27-15-20(17-5-3-2-4-6-17)21-22(25-16-26-23(21)27)24-11-13-30-14-12-28/h2-10,15-16,28H,11-14H2,1H3,(H,24,25,26) |
| InChIKey | TWNJYCIPRZLHKQ-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 81.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.47 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|