About dimethoxy-sulfanylidene-sulfido-λ5-phosphane;6-phenyl-2-(sulfanylmethyl)pyridazin-3-one
dimethoxy-sulfanylidene-sulfido-λ5-phosphane;6-phenyl-2-(sulfanylmethyl)pyridazin-3-one (PubChem CID 21151593) has the molecular formula C13H16N2O3PS3-
and a molecular weight of 375.46 g/mol. Its IUPAC name is dimethoxy-sulfanylidene-sulfido-λ5-phosphane;6-phenyl-2-(sulfanylmethyl)pyridazin-3-one.
Molecular Properties
| Compound Name | dimethoxy-sulfanylidene-sulfido-λ5-phosphane;6-phenyl-2-(sulfanylmethyl)pyridazin-3-one |
| PubChem CID | 21151593 |
| Molecular Formula | C13H16N2O3PS3- |
| Molecular Weight | 375.46 g/mol |
| Exact Mass | 375.01 |
| IUPAC Name | dimethoxy-sulfanylidene-sulfido-λ5-phosphane;6-phenyl-2-(sulfanylmethyl)pyridazin-3-one |
| SMILES | COP(=S)([S-])OC.O=c1ccc(-c2ccccc2)nn1CS |
| InChI | InChI=1S/C11H10N2OS.C2H7O2PS2/c14-11-7-6-10(12-13(11)8-15)9-4-2-1-3-5-9;1-3-5(6,7)4-2/h1-7,15H,8H2;1-2H3,(H,6,7)/p-1 |
| InChIKey | OFZWXHHEXCWMOV-UHFFFAOYSA-M |
| XLogP | 2.85 |
| TPSA | 53.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 375.46 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'thiol_1', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze dimethoxy-sulfanylidene-sulfido-λ5-phosphane;6-phenyl-2-(sulfanylmethyl)pyridazin-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dimethoxy-sulfanylidene-sulfido-λ5-phosphane;6-phenyl-2-(sulfanylmethyl)pyridazin-3-one?
The IUPAC name of dimethoxy-sulfanylidene-sulfido-λ5-phosphane;6-phenyl-2-(sulfanylmethyl)pyridazin-3-one (CID 21151593) is dimethoxy-sulfanylidene-sulfido-λ5-phosphane;6-phenyl-2-(sulfanylmethyl)pyridazin-3-one.
What is the SMILES notation for dimethoxy-sulfanylidene-sulfido-λ5-phosphane;6-phenyl-2-(sulfanylmethyl)pyridazin-3-one?
The canonical SMILES for dimethoxy-sulfanylidene-sulfido-λ5-phosphane;6-phenyl-2-(sulfanylmethyl)pyridazin-3-one is COP(=S)([S-])OC.O=c1ccc(-c2ccccc2)nn1CS.
What is the InChIKey of dimethoxy-sulfanylidene-sulfido-λ5-phosphane;6-phenyl-2-(sulfanylmethyl)pyridazin-3-one?
The InChIKey is OFZWXHHEXCWMOV-UHFFFAOYSA-M. The full InChI is InChI=1S/C11H10N2OS.C2H7O2PS2/c14-11-7-6-10(12-13(11)8-15)9-4-2-1-3-5-9;1-3-5(6,7)4-2/h1-7,15H,8H2;1-2H3,(H,6,7)/p-1.
What are the key properties of dimethoxy-sulfanylidene-sulfido-λ5-phosphane;6-phenyl-2-(sulfanylmethyl)pyridazin-3-one?
dimethoxy-sulfanylidene-sulfido-λ5-phosphane;6-phenyl-2-(sulfanylmethyl)pyridazin-3-one has a molecular weight of 375.46 g/mol, XLogP of 2.85, 4 rotatable bonds, 1 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for dimethoxy-sulfanylidene-sulfido-λ5-phosphane;6-phenyl-2-(sulfanylmethyl)pyridazin-3-one is sourced from PubChem (CID 21151593), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).