C21H23NO3 — CID 21159664
8-(3-aminopentan-3-yl)-7-hydroxy-2-methyl-3-phenylchromen-4-one (PubChem CID 21159664) has the molecular formula C21H23NO3 and a molecular weight of 337.42 g/mol. Its IUPAC name is 8-(3-aminopentan-3-yl)-7-hydroxy-2-methyl-3-phenylchromen-4-one.
| Compound Name | 8-(3-aminopentan-3-yl)-7-hydroxy-2-methyl-3-phenylchromen-4-one |
|---|---|
| PubChem CID | 21159664 |
| Molecular Formula | C21H23NO3 |
| Molecular Weight | 337.42 g/mol |
| Exact Mass | 337.17 |
| IUPAC Name | 8-(3-aminopentan-3-yl)-7-hydroxy-2-methyl-3-phenylchromen-4-one |
| SMILES | CCC(N)(CC)c1c(O)ccc2c(=O)c(-c3ccccc3)c(C)oc12 |
| InChI | InChI=1S/C21H23NO3/c1-4-21(22,5-2)18-16(23)12-11-15-19(24)17(13(3)25-20(15)18)14-9-7-6-8-10-14/h6-12,23H,4-5,22H2,1-3H3 |
| InChIKey | FLBHWEHTWXEPRM-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 76.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.42 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|