C25H28N2O5S — CID 30013804
8-[[4-[(3S)-1,1-dioxothiolan-3-yl]piperazin-1-yl]methyl]-7-hydroxy-2-methyl-3-phenylchromen-4-one (PubChem CID 30013804) has the molecular formula C25H28N2O5S and a molecular weight of 468.58 g/mol. Its IUPAC name is 8-[[4-[(3S)-1,1-dioxothiolan-3-yl]piperazin-1-yl]methyl]-7-hydroxy-2-methyl-3-phenylchromen-4-one.
| Compound Name | 8-[[4-[(3S)-1,1-dioxothiolan-3-yl]piperazin-1-yl]methyl]-7-hydroxy-2-methyl-3-phenylchromen-4-one |
|---|---|
| PubChem CID | 30013804 |
| Molecular Formula | C25H28N2O5S |
| Molecular Weight | 468.58 g/mol |
| Exact Mass | 468.17 |
| IUPAC Name | 8-[[4-[(3S)-1,1-dioxothiolan-3-yl]piperazin-1-yl]methyl]-7-hydroxy-2-methyl-3-phenylchromen-4-one |
| SMILES | Cc1oc2c(CN3CCN([C@H]4CCS(=O)(=O)C4)CC3)c(O)ccc2c(=O)c1-c1ccccc1 |
| InChI | InChI=1S/C25H28N2O5S/c1-17-23(18-5-3-2-4-6-18)24(29)20-7-8-22(28)21(25(20)32-17)15-26-10-12-27(13-11-26)19-9-14-33(30,31)16-19/h2-8,19,28H,9-16H2,1H3/t19-/m0/s1 |
| InChIKey | HJPCNQDJMOMWJE-IBGZPJMESA-N |
| XLogP | 2.78 |
| TPSA | 91.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.58 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|