C11H18O2 — CID 21159772
(4E)-4-(hydroxymethylidene)-2,6-dimethyloct-7-en-3-one (PubChem CID 21159772) has the molecular formula C11H18O2 and a molecular weight of 182.26 g/mol. Its IUPAC name is (4E)-4-(hydroxymethylidene)-2,6-dimethyloct-7-en-3-one.
| Compound Name | (4E)-4-(hydroxymethylidene)-2,6-dimethyloct-7-en-3-one |
|---|---|
| PubChem CID | 21159772 |
| Molecular Formula | C11H18O2 |
| Molecular Weight | 182.26 g/mol |
| Exact Mass | 182.13 |
| IUPAC Name | (4E)-4-(hydroxymethylidene)-2,6-dimethyloct-7-en-3-one |
| SMILES | C=CC(C)C/C(=C\O)C(=O)C(C)C |
| InChI | InChI=1S/C11H18O2/c1-5-9(4)6-10(7-12)11(13)8(2)3/h5,7-9,12H,1,6H2,2-4H3/b10-7+ |
| InChIKey | YPZNITCWPQBUSE-JXMROGBWSA-N |
| XLogP | 2.87 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.26 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'keto_keto_beta_D(5)', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|