C14H24O3 — CID 137483513
(4E)-4-(hydroxymethylidene)-2,6,9-trimethyldecane-3,5-dione (PubChem CID 137483513) has the molecular formula C14H24O3 and a molecular weight of 240.34 g/mol. Its IUPAC name is (4E)-4-(hydroxymethylidene)-2,6,9-trimethyldecane-3,5-dione.
| Compound Name | (4E)-4-(hydroxymethylidene)-2,6,9-trimethyldecane-3,5-dione |
|---|---|
| PubChem CID | 137483513 |
| Molecular Formula | C14H24O3 |
| Molecular Weight | 240.34 g/mol |
| Exact Mass | 240.17 |
| IUPAC Name | (4E)-4-(hydroxymethylidene)-2,6,9-trimethyldecane-3,5-dione |
| SMILES | CC(C)CCC(C)C(=O)/C(=C/O)C(=O)C(C)C |
| InChI | InChI=1S/C14H24O3/c1-9(2)6-7-11(5)14(17)12(8-15)13(16)10(3)4/h8-11,15H,6-7H2,1-5H3/b12-8+ |
| InChIKey | RUGYTIROASECLT-XYOKQWHBSA-N |
| XLogP | 3.29 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.34 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'keto_keto_beta_D(5)', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|