About S-propan-2-yl (Z)-3-ethylsulfanylbut-2-enethioate
S-propan-2-yl (Z)-3-ethylsulfanylbut-2-enethioate (PubChem CID 21160498) has the molecular formula C9H16OS2
and a molecular weight of 204.36 g/mol. Its IUPAC name is S-propan-2-yl (Z)-3-ethylsulfanylbut-2-enethioate.
Molecular Properties
| Compound Name | S-propan-2-yl (Z)-3-ethylsulfanylbut-2-enethioate |
| PubChem CID | 21160498 |
| Molecular Formula | C9H16OS2 |
| Molecular Weight | 204.36 g/mol |
| Exact Mass | 204.06 |
| IUPAC Name | S-propan-2-yl (Z)-3-ethylsulfanylbut-2-enethioate |
| SMILES | CCS/C(C)=C\C(=O)SC(C)C |
| InChI | InChI=1S/C9H16OS2/c1-5-11-8(4)6-9(10)12-7(2)3/h6-7H,5H2,1-4H3/b8-6- |
| InChIKey | UXOOFPWRVRBLIY-VURMDHGXSA-N |
| XLogP | 3.31 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 204.36 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|
Analyze S-propan-2-yl (Z)-3-ethylsulfanylbut-2-enethioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of S-propan-2-yl (Z)-3-ethylsulfanylbut-2-enethioate?
The IUPAC name of S-propan-2-yl (Z)-3-ethylsulfanylbut-2-enethioate (CID 21160498) is S-propan-2-yl (Z)-3-ethylsulfanylbut-2-enethioate.
What is the SMILES notation for S-propan-2-yl (Z)-3-ethylsulfanylbut-2-enethioate?
The canonical SMILES for S-propan-2-yl (Z)-3-ethylsulfanylbut-2-enethioate is CCS/C(C)=C\C(=O)SC(C)C.
What is the InChIKey of S-propan-2-yl (Z)-3-ethylsulfanylbut-2-enethioate?
The InChIKey is UXOOFPWRVRBLIY-VURMDHGXSA-N. The full InChI is InChI=1S/C9H16OS2/c1-5-11-8(4)6-9(10)12-7(2)3/h6-7H,5H2,1-4H3/b8-6-.
What are the key properties of S-propan-2-yl (Z)-3-ethylsulfanylbut-2-enethioate?
S-propan-2-yl (Z)-3-ethylsulfanylbut-2-enethioate has a molecular weight of 204.36 g/mol, XLogP of 3.31, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for S-propan-2-yl (Z)-3-ethylsulfanylbut-2-enethioate is sourced from PubChem (CID 21160498), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).