C10H20O2S — CID 13173023
(E)-1,1-diethoxy-3-ethylsulfanylbut-2-ene (PubChem CID 13173023) has the molecular formula C10H20O2S and a molecular weight of 204.33 g/mol. Its IUPAC name is (E)-1,1-diethoxy-3-ethylsulfanylbut-2-ene.
| Compound Name | (E)-1,1-diethoxy-3-ethylsulfanylbut-2-ene |
|---|---|
| PubChem CID | 13173023 |
| Molecular Formula | C10H20O2S |
| Molecular Weight | 204.33 g/mol |
| Exact Mass | 204.12 |
| IUPAC Name | (E)-1,1-diethoxy-3-ethylsulfanylbut-2-ene |
| SMILES | CCOC(/C=C(\C)SCC)OCC |
| InChI | InChI=1S/C10H20O2S/c1-5-11-10(12-6-2)8-9(4)13-7-3/h8,10H,5-7H2,1-4H3/b9-8+ |
| InChIKey | YGRVTGCDIBLNMY-CMDGGOBGSA-N |
| XLogP | 3.04 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.33 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|