C9H10N2O — CID 21160677
1-[(6Z)-6-diazo-5-methylcyclohexa-2,4-dien-1-yl]ethanone (PubChem CID 21160677) has the molecular formula C9H10N2O and a molecular weight of 162.19 g/mol. Its IUPAC name is 1-[(6Z)-6-diazo-5-methylcyclohexa-2,4-dien-1-yl]ethanone.
| Compound Name | 1-[(6Z)-6-diazo-5-methylcyclohexa-2,4-dien-1-yl]ethanone |
|---|---|
| PubChem CID | 21160677 |
| Molecular Formula | C9H10N2O |
| Molecular Weight | 162.19 g/mol |
| Exact Mass | 162.08 |
| IUPAC Name | 1-[(6Z)-6-diazo-5-methylcyclohexa-2,4-dien-1-yl]ethanone |
| SMILES | CC(=O)C1C=CC=C(C)C1=[N+]=[N-] |
| InChI | InChI=1S/C9H10N2O/c1-6-4-3-5-8(7(2)12)9(6)11-10/h3-5,8H,1-2H3 |
| InChIKey | JATJYOYXZVNNFU-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 53.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 162.19 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|