C21H19ClN2O6 — CID 2116223
[2-oxo-2-(3-oxo-4H-1,4-benzoxazin-6-yl)ethyl] 4-[(4-chlorobenzoyl)amino]butanoate (PubChem CID 2116223) has the molecular formula C21H19ClN2O6 and a molecular weight of 430.84 g/mol. Its IUPAC name is [2-oxo-2-(3-oxo-4H-1,4-benzoxazin-6-yl)ethyl] 4-[(4-chlorobenzoyl)amino]butanoate.
| Compound Name | [2-oxo-2-(3-oxo-4H-1,4-benzoxazin-6-yl)ethyl] 4-[(4-chlorobenzoyl)amino]butanoate |
|---|---|
| PubChem CID | 2116223 |
| Molecular Formula | C21H19ClN2O6 |
| Molecular Weight | 430.84 g/mol |
| Exact Mass | 430.09 |
| IUPAC Name | [2-oxo-2-(3-oxo-4H-1,4-benzoxazin-6-yl)ethyl] 4-[(4-chlorobenzoyl)amino]butanoate |
| SMILES | O=C1COc2ccc(C(=O)COC(=O)CCCNC(=O)c3ccc(Cl)cc3)cc2N1 |
| InChI | InChI=1S/C21H19ClN2O6/c22-15-6-3-13(4-7-15)21(28)23-9-1-2-20(27)30-11-17(25)14-5-8-18-16(10-14)24-19(26)12-29-18/h3-8,10H,1-2,9,11-12H2,(H,23,28)(H,24,26) |
| InChIKey | ZSJVVRFFWDPSTK-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 110.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.84 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|