C21H18O6 — CID 21163126
(E)-3-[4-oxo-7-(3-phenoxypropoxy)chromen-2-yl]prop-2-enoic acid (PubChem CID 21163126) has the molecular formula C21H18O6 and a molecular weight of 366.37 g/mol. Its IUPAC name is (E)-3-[4-oxo-7-(3-phenoxypropoxy)chromen-2-yl]prop-2-enoic acid.
| Compound Name | (E)-3-[4-oxo-7-(3-phenoxypropoxy)chromen-2-yl]prop-2-enoic acid |
|---|---|
| PubChem CID | 21163126 |
| Molecular Formula | C21H18O6 |
| Molecular Weight | 366.37 g/mol |
| Exact Mass | 366.11 |
| IUPAC Name | (E)-3-[4-oxo-7-(3-phenoxypropoxy)chromen-2-yl]prop-2-enoic acid |
| SMILES | O=C(O)/C=C/c1cc(=O)c2ccc(OCCCOc3ccccc3)cc2o1 |
| InChI | InChI=1S/C21H18O6/c22-19-13-17(8-10-21(23)24)27-20-14-16(7-9-18(19)20)26-12-4-11-25-15-5-2-1-3-6-15/h1-3,5-10,13-14H,4,11-12H2,(H,23,24)/b10-8+ |
| InChIKey | DZTPGPLBRIIOKM-CSKARUKUSA-N |
| XLogP | 3.74 |
| TPSA | 85.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.37 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|