About 5-propylsulfonyl-1,3,4-thiadiazole-2-carbonitrile
5-propylsulfonyl-1,3,4-thiadiazole-2-carbonitrile (PubChem CID 21163850) has the molecular formula C6H7N3O2S2
and a molecular weight of 217.27 g/mol. Its IUPAC name is 5-propylsulfonyl-1,3,4-thiadiazole-2-carbonitrile.
Molecular Properties
| Compound Name | 5-propylsulfonyl-1,3,4-thiadiazole-2-carbonitrile |
| PubChem CID | 21163850 |
| Molecular Formula | C6H7N3O2S2 |
| Molecular Weight | 217.27 g/mol |
| Exact Mass | 217.00 |
| IUPAC Name | 5-propylsulfonyl-1,3,4-thiadiazole-2-carbonitrile |
| SMILES | CCCS(=O)(=O)c1nnc(C#N)s1 |
| InChI | InChI=1S/C6H7N3O2S2/c1-2-3-13(10,11)6-9-8-5(4-7)12-6/h2-3H2,1H3 |
| InChIKey | SLHFIJRYKZTCDF-UHFFFAOYSA-N |
| XLogP | 0.59 |
| TPSA | 83.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 217.27 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 5-propylsulfonyl-1,3,4-thiadiazole-2-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-propylsulfonyl-1,3,4-thiadiazole-2-carbonitrile?
The IUPAC name of 5-propylsulfonyl-1,3,4-thiadiazole-2-carbonitrile (CID 21163850) is 5-propylsulfonyl-1,3,4-thiadiazole-2-carbonitrile.
What is the SMILES notation for 5-propylsulfonyl-1,3,4-thiadiazole-2-carbonitrile?
The canonical SMILES for 5-propylsulfonyl-1,3,4-thiadiazole-2-carbonitrile is CCCS(=O)(=O)c1nnc(C#N)s1.
What is the InChIKey of 5-propylsulfonyl-1,3,4-thiadiazole-2-carbonitrile?
The InChIKey is SLHFIJRYKZTCDF-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H7N3O2S2/c1-2-3-13(10,11)6-9-8-5(4-7)12-6/h2-3H2,1H3.
What are the key properties of 5-propylsulfonyl-1,3,4-thiadiazole-2-carbonitrile?
5-propylsulfonyl-1,3,4-thiadiazole-2-carbonitrile has a molecular weight of 217.27 g/mol, XLogP of 0.59, 3 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 5-propylsulfonyl-1,3,4-thiadiazole-2-carbonitrile is sourced from PubChem (CID 21163850), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).