C19H18Br2N2O2 — CID 21176835
2-(4-bromophenyl)-1-(4-methoxyphenyl)-6,8-dihydro-5H-imidazo[2,1-c][1,4]oxazin-4-ium bromide (PubChem CID 21176835) has the molecular formula C19H18Br2N2O2 and a molecular weight of 466.17 g/mol. Its IUPAC name is 2-(4-bromophenyl)-1-(4-methoxyphenyl)-6,8-dihydro-5H-imidazo[2,1-c][1,4]oxazin-4-ium bromide.
| Compound Name | 2-(4-bromophenyl)-1-(4-methoxyphenyl)-6,8-dihydro-5H-imidazo[2,1-c][1,4]oxazin-4-ium bromide |
|---|---|
| PubChem CID | 21176835 |
| Molecular Formula | C19H18Br2N2O2 |
| Molecular Weight | 466.17 g/mol |
| Exact Mass | 463.97 |
| IUPAC Name | 2-(4-bromophenyl)-1-(4-methoxyphenyl)-6,8-dihydro-5H-imidazo[2,1-c][1,4]oxazin-4-ium bromide |
| SMILES | COc1ccc(-n2c(-c3ccc(Br)cc3)c[n+]3c2COCC3)cc1.[Br-] |
| InChI | InChI=1S/C19H18BrN2O2.BrH/c1-23-17-8-6-16(7-9-17)22-18(14-2-4-15(20)5-3-14)12-21-10-11-24-13-19(21)22;/h2-9,12H,10-11,13H2,1H3;1H/q+1;/p-1 |
| InChIKey | OWBQFWXEUBCCBO-UHFFFAOYSA-M |
| XLogP | 0.74 |
| TPSA | 27.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.17 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|