C22H24Br2N2S — CID 45052932
2-(4-bromophenyl)-1-(4-tert-butylphenyl)-6,7-dihydro-5H-imidazo[2,1-b][1,3]thiazin-4-ium bromide (PubChem CID 45052932) has the molecular formula C22H24Br2N2S and a molecular weight of 508.32 g/mol. Its IUPAC name is 2-(4-bromophenyl)-1-(4-tert-butylphenyl)-6,7-dihydro-5H-imidazo[2,1-b][1,3]thiazin-4-ium bromide.
| Compound Name | 2-(4-bromophenyl)-1-(4-tert-butylphenyl)-6,7-dihydro-5H-imidazo[2,1-b][1,3]thiazin-4-ium bromide |
|---|---|
| PubChem CID | 45052932 |
| Molecular Formula | C22H24Br2N2S |
| Molecular Weight | 508.32 g/mol |
| Exact Mass | 506.00 |
| IUPAC Name | 2-(4-bromophenyl)-1-(4-tert-butylphenyl)-6,7-dihydro-5H-imidazo[2,1-b][1,3]thiazin-4-ium bromide |
| SMILES | CC(C)(C)c1ccc(-n2c(-c3ccc(Br)cc3)c[n+]3c2SCCC3)cc1.[Br-] |
| InChI | InChI=1S/C22H24BrN2S.BrH/c1-22(2,3)17-7-11-19(12-8-17)25-20(16-5-9-18(23)10-6-16)15-24-13-4-14-26-21(24)25;/h5-12,15H,4,13-14H2,1-3H3;1H/q+1;/p-1 |
| InChIKey | YMGAPLBIXBXODI-UHFFFAOYSA-M |
| XLogP | 2.99 |
| TPSA | 8.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.32 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|