C20H20BrN2O2S+ — CID 126958335
7-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)-6-phenyl-2,3-dihydroimidazo[2,1-b][1,3]thiazol-4-ium;hydrobromide (PubChem CID 126958335) has the molecular formula C20H20BrN2O2S+ and a molecular weight of 432.36 g/mol. Its IUPAC name is 7-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)-6-phenyl-2,3-dihydroimidazo[2,1-b][1,3]thiazol-4-ium;hydrobromide.
| Compound Name | 7-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)-6-phenyl-2,3-dihydroimidazo[2,1-b][1,3]thiazol-4-ium;hydrobromide |
|---|---|
| PubChem CID | 126958335 |
| Molecular Formula | C20H20BrN2O2S+ |
| Molecular Weight | 432.36 g/mol |
| Exact Mass | 431.04 |
| IUPAC Name | 7-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)-6-phenyl-2,3-dihydroimidazo[2,1-b][1,3]thiazol-4-ium;hydrobromide |
| SMILES | Br.c1ccc(-c2c[n+]3c(n2-c2ccc4c(c2)OCCCO4)SCC3)cc1 |
| InChI | InChI=1S/C20H19N2O2S.BrH/c1-2-5-15(6-3-1)17-14-21-9-12-25-20(21)22(17)16-7-8-18-19(13-16)24-11-4-10-23-18;/h1-3,5-8,13-14H,4,9-12H2;1H/q+1; |
| InChIKey | YISSMZUFJVNTDJ-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 27.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.36 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|