About 4-fluoro-N-(4-hydroxy-1,1-dioxothiolan-3-yl)-N-(3-methylphenyl)benzamide
4-fluoro-N-(4-hydroxy-1,1-dioxothiolan-3-yl)-N-(3-methylphenyl)benzamide (PubChem CID 21178410) has the molecular formula C18H18FNO4S
and a molecular weight of 363.41 g/mol. Its IUPAC name is 4-fluoro-N-(4-hydroxy-1,1-dioxothiolan-3-yl)-N-(3-methylphenyl)benzamide.
Molecular Properties
| Compound Name | 4-fluoro-N-(4-hydroxy-1,1-dioxothiolan-3-yl)-N-(3-methylphenyl)benzamide |
| PubChem CID | 21178410 |
| Molecular Formula | C18H18FNO4S |
| Molecular Weight | 363.41 g/mol |
| Exact Mass | 363.09 |
| IUPAC Name | 4-fluoro-N-(4-hydroxy-1,1-dioxothiolan-3-yl)-N-(3-methylphenyl)benzamide |
| SMILES | Cc1cccc(N(C(=O)c2ccc(F)cc2)C2CS(=O)(=O)CC2O)c1 |
| InChI | InChI=1S/C18H18FNO4S/c1-12-3-2-4-15(9-12)20(16-10-25(23,24)11-17(16)21)18(22)13-5-7-14(19)8-6-13/h2-9,16-17,21H,10-11H2,1H3 |
| InChIKey | FYJIDIRNWAYHRD-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 363.41 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-fluoro-N-(4-hydroxy-1,1-dioxothiolan-3-yl)-N-(3-methylphenyl)benzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-fluoro-N-(4-hydroxy-1,1-dioxothiolan-3-yl)-N-(3-methylphenyl)benzamide?
The IUPAC name of 4-fluoro-N-(4-hydroxy-1,1-dioxothiolan-3-yl)-N-(3-methylphenyl)benzamide (CID 21178410) is 4-fluoro-N-(4-hydroxy-1,1-dioxothiolan-3-yl)-N-(3-methylphenyl)benzamide.
What is the SMILES notation for 4-fluoro-N-(4-hydroxy-1,1-dioxothiolan-3-yl)-N-(3-methylphenyl)benzamide?
The canonical SMILES for 4-fluoro-N-(4-hydroxy-1,1-dioxothiolan-3-yl)-N-(3-methylphenyl)benzamide is Cc1cccc(N(C(=O)c2ccc(F)cc2)C2CS(=O)(=O)CC2O)c1.
What is the InChIKey of 4-fluoro-N-(4-hydroxy-1,1-dioxothiolan-3-yl)-N-(3-methylphenyl)benzamide?
The InChIKey is FYJIDIRNWAYHRD-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H18FNO4S/c1-12-3-2-4-15(9-12)20(16-10-25(23,24)11-17(16)21)18(22)13-5-7-14(19)8-6-13/h2-9,16-17,21H,10-11H2,1H3.
What are the key properties of 4-fluoro-N-(4-hydroxy-1,1-dioxothiolan-3-yl)-N-(3-methylphenyl)benzamide?
4-fluoro-N-(4-hydroxy-1,1-dioxothiolan-3-yl)-N-(3-methylphenyl)benzamide has a molecular weight of 363.41 g/mol, XLogP of 1.94, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-fluoro-N-(4-hydroxy-1,1-dioxothiolan-3-yl)-N-(3-methylphenyl)benzamide is sourced from PubChem (CID 21178410), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).