C12H15ClNO2S- — CID 21178477
N-benzyl-1-(1,1-dioxo-2,5-dihydrothiophen-3-yl)methanamine chloride (PubChem CID 21178477) has the molecular formula C12H15ClNO2S- and a molecular weight of 272.78 g/mol. Its IUPAC name is N-benzyl-1-(1,1-dioxo-2,5-dihydrothiophen-3-yl)methanamine chloride.
| Compound Name | N-benzyl-1-(1,1-dioxo-2,5-dihydrothiophen-3-yl)methanamine chloride |
|---|---|
| PubChem CID | 21178477 |
| Molecular Formula | C12H15ClNO2S- |
| Molecular Weight | 272.78 g/mol |
| Exact Mass | 272.05 |
| IUPAC Name | N-benzyl-1-(1,1-dioxo-2,5-dihydrothiophen-3-yl)methanamine chloride |
| SMILES | O=S1(=O)CC=C(CNCc2ccccc2)C1.[Cl-] |
| InChI | InChI=1S/C12H15NO2S.ClH/c14-16(15)7-6-12(10-16)9-13-8-11-4-2-1-3-5-11;/h1-6,13H,7-10H2;1H/p-1 |
| InChIKey | YMAAUMCAMPGPAU-UHFFFAOYSA-M |
| XLogP | -1.87 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.78 |
| LogP ≤ 5 | -1.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|