C8H16N4O4S — CID 21178486
2-[4-(2-hydrazinyl-2-oxoethyl)-1,1-dioxothiolan-3-yl]acetohydrazide (PubChem CID 21178486) has the molecular formula C8H16N4O4S and a molecular weight of 264.31 g/mol. Its IUPAC name is 2-[4-(2-hydrazinyl-2-oxoethyl)-1,1-dioxothiolan-3-yl]acetohydrazide.
| Compound Name | 2-[4-(2-hydrazinyl-2-oxoethyl)-1,1-dioxothiolan-3-yl]acetohydrazide |
|---|---|
| PubChem CID | 21178486 |
| Molecular Formula | C8H16N4O4S |
| Molecular Weight | 264.31 g/mol |
| Exact Mass | 264.09 |
| IUPAC Name | 2-[4-(2-hydrazinyl-2-oxoethyl)-1,1-dioxothiolan-3-yl]acetohydrazide |
| SMILES | NNC(=O)CC1CS(=O)(=O)CC1CC(=O)NN |
| InChI | InChI=1S/C8H16N4O4S/c9-11-7(13)1-5-3-17(15,16)4-6(5)2-8(14)12-10/h5-6H,1-4,9-10H2,(H,11,13)(H,12,14) |
| InChIKey | SVFSCVFGFZAFQF-UHFFFAOYSA-N |
| XLogP | -2.59 |
| TPSA | 144.38 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.31 |
| LogP ≤ 5 | -2.59 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|