C15H13F3OS — CID 21179148
1,1,1-trifluoro-3-phenyl-3-phenylsulfanylpropan-2-ol (PubChem CID 21179148) has the molecular formula C15H13F3OS and a molecular weight of 298.33 g/mol. Its IUPAC name is 1,1,1-trifluoro-3-phenyl-3-phenylsulfanylpropan-2-ol.
| Compound Name | 1,1,1-trifluoro-3-phenyl-3-phenylsulfanylpropan-2-ol |
|---|---|
| PubChem CID | 21179148 |
| Molecular Formula | C15H13F3OS |
| Molecular Weight | 298.33 g/mol |
| Exact Mass | 298.06 |
| IUPAC Name | 1,1,1-trifluoro-3-phenyl-3-phenylsulfanylpropan-2-ol |
| SMILES | OC(C(Sc1ccccc1)c1ccccc1)C(F)(F)F |
| InChI | InChI=1S/C15H13F3OS/c16-15(17,18)14(19)13(11-7-3-1-4-8-11)20-12-9-5-2-6-10-12/h1-10,13-14,19H |
| InChIKey | MYKQKGDWURBLNR-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.33 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |