C9H17ClNO3S- — CID 21179773
1,1-dioxo-4-piperidin-1-ylthiolan-3-ol chloride (PubChem CID 21179773) has the molecular formula C9H17ClNO3S- and a molecular weight of 254.76 g/mol. Its IUPAC name is 1,1-dioxo-4-piperidin-1-ylthiolan-3-ol chloride.
| Compound Name | 1,1-dioxo-4-piperidin-1-ylthiolan-3-ol chloride |
|---|---|
| PubChem CID | 21179773 |
| Molecular Formula | C9H17ClNO3S- |
| Molecular Weight | 254.76 g/mol |
| Exact Mass | 254.06 |
| IUPAC Name | 1,1-dioxo-4-piperidin-1-ylthiolan-3-ol chloride |
| SMILES | O=S1(=O)CC(O)C(N2CCCCC2)C1.[Cl-] |
| InChI | InChI=1S/C9H17NO3S.ClH/c11-9-7-14(12,13)6-8(9)10-4-2-1-3-5-10;/h8-9,11H,1-7H2;1H/p-1 |
| InChIKey | PBZBCXATOIFCLZ-UHFFFAOYSA-M |
| XLogP | -3.37 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.76 |
| LogP ≤ 5 | -3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |