C7H9N — CID 21183536
2,6-dimethylidene-3H-pyridine (PubChem CID 21183536) has the molecular formula C7H9N and a molecular weight of 107.16 g/mol. Its IUPAC name is 2,6-dimethylidene-3H-pyridine.
| Compound Name | 2,6-dimethylidene-3H-pyridine |
|---|---|
| PubChem CID | 21183536 |
| Molecular Formula | C7H9N |
| Molecular Weight | 107.16 g/mol |
| Exact Mass | 107.07 |
| IUPAC Name | 2,6-dimethylidene-3H-pyridine |
| SMILES | C=C1C=CCC(=C)N1 |
| InChI | InChI=1S/C7H9N/c1-6-4-3-5-7(2)8-6/h3-4,8H,1-2,5H2 |
| InChIKey | OPMSJQNVJFWBJE-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 107.16 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |