C9H13N — CID 45079874
3,4,6-trimethyl-2-methylidene-1H-pyridine (PubChem CID 45079874) has the molecular formula C9H13N and a molecular weight of 135.21 g/mol. Its IUPAC name is 3,4,6-trimethyl-2-methylidene-1H-pyridine.
| Compound Name | 3,4,6-trimethyl-2-methylidene-1H-pyridine |
|---|---|
| PubChem CID | 45079874 |
| Molecular Formula | C9H13N |
| Molecular Weight | 135.21 g/mol |
| Exact Mass | 135.10 |
| IUPAC Name | 3,4,6-trimethyl-2-methylidene-1H-pyridine |
| SMILES | C=C1NC(C)=CC(C)=C1C |
| InChI | InChI=1S/C9H13N/c1-6-5-7(2)10-9(4)8(6)3/h5,10H,4H2,1-3H3 |
| InChIKey | IFPUBRBSUPJKDB-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 135.21 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |