C17H14N4O4S — CID 21190176
N-[4-[(5,7-dioxo-2,6,12-triazatricyclo[6.3.1.04,12]dodeca-1,3,8,10-tetraen-6-yl)methyl]phenyl]methanesulfonamide (PubChem CID 21190176) has the molecular formula C17H14N4O4S and a molecular weight of 370.39 g/mol. Its IUPAC name is N-[4-[(5,7-dioxo-2,6,12-triazatricyclo[6.3.1.04,12]dodeca-1,3,8,10-tetraen-6-yl)methyl]phenyl]methanesulfonamide.
| Compound Name | N-[4-[(5,7-dioxo-2,6,12-triazatricyclo[6.3.1.04,12]dodeca-1,3,8,10-tetraen-6-yl)methyl]phenyl]methanesulfonamide |
|---|---|
| PubChem CID | 21190176 |
| Molecular Formula | C17H14N4O4S |
| Molecular Weight | 370.39 g/mol |
| Exact Mass | 370.07 |
| IUPAC Name | N-[4-[(5,7-dioxo-2,6,12-triazatricyclo[6.3.1.04,12]dodeca-1,3,8,10-tetraen-6-yl)methyl]phenyl]methanesulfonamide |
| SMILES | CS(=O)(=O)Nc1ccc(Cn2c(=O)c3cccc4ncc(c2=O)n43)cc1 |
| InChI | InChI=1S/C17H14N4O4S/c1-26(24,25)19-12-7-5-11(6-8-12)10-20-16(22)13-3-2-4-15-18-9-14(17(20)23)21(13)15/h2-9,19H,10H2,1H3 |
| InChIKey | FFBBMKQJLAYTOT-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 102.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.39 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |