C14H20N4O2S — CID 21190605
tert-butyl 4-(2,2-dicyano-1-methylsulfanylethenyl)piperazine-1-carboxylate (PubChem CID 21190605) has the molecular formula C14H20N4O2S and a molecular weight of 308.41 g/mol. Its IUPAC name is tert-butyl 4-(2,2-dicyano-1-methylsulfanylethenyl)piperazine-1-carboxylate.
| Compound Name | tert-butyl 4-(2,2-dicyano-1-methylsulfanylethenyl)piperazine-1-carboxylate |
|---|---|
| PubChem CID | 21190605 |
| Molecular Formula | C14H20N4O2S |
| Molecular Weight | 308.41 g/mol |
| Exact Mass | 308.13 |
| IUPAC Name | tert-butyl 4-(2,2-dicyano-1-methylsulfanylethenyl)piperazine-1-carboxylate |
| SMILES | CSC(=C(C#N)C#N)N1CCN(C(=O)OC(C)(C)C)CC1 |
| InChI | InChI=1S/C14H20N4O2S/c1-14(2,3)20-13(19)18-7-5-17(6-8-18)12(21-4)11(9-15)10-16/h5-8H2,1-4H3 |
| InChIKey | HAAUAYWHANRJQD-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 80.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.41 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|