C19H25N7O2 — CID 21190714
tert-butyl N-[[3-[[4-cyano-3-(dimethylaminomethylideneamino)-1H-pyrazol-5-yl]amino]phenyl]methyl]carbamate (PubChem CID 21190714) has the molecular formula C19H25N7O2 and a molecular weight of 383.46 g/mol. Its IUPAC name is tert-butyl N-[[3-[[4-cyano-3-(dimethylaminomethylideneamino)-1H-pyrazol-5-yl]amino]phenyl]methyl]carbamate.
| Compound Name | tert-butyl N-[[3-[[4-cyano-3-(dimethylaminomethylideneamino)-1H-pyrazol-5-yl]amino]phenyl]methyl]carbamate |
|---|---|
| PubChem CID | 21190714 |
| Molecular Formula | C19H25N7O2 |
| Molecular Weight | 383.46 g/mol |
| Exact Mass | 383.21 |
| IUPAC Name | tert-butyl N-[[3-[[4-cyano-3-(dimethylaminomethylideneamino)-1H-pyrazol-5-yl]amino]phenyl]methyl]carbamate |
| SMILES | CN(C)/C=N/c1n[nH]c(Nc2cccc(CNC(=O)OC(C)(C)C)c2)c1C#N |
| InChI | InChI=1S/C19H25N7O2/c1-19(2,3)28-18(27)21-11-13-7-6-8-14(9-13)23-17-15(10-20)16(24-25-17)22-12-26(4)5/h6-9,12H,11H2,1-5H3,(H,21,27)(H2,23,24,25)/b22-12+ |
| InChIKey | WXGZWQCBIIDZMZ-WSDLNYQXSA-N |
| XLogP | 3.27 |
| TPSA | 118.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.46 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|