About ethyl 5-hydroxy-5-methoxy-3-oxopentanoate;5-oxabicyclo[2.1.1]hexane
ethyl 5-hydroxy-5-methoxy-3-oxopentanoate;5-oxabicyclo[2.1.1]hexane (PubChem CID 21193727) has the molecular formula C13H22O6
and a molecular weight of 274.31 g/mol. Its IUPAC name is ethyl 5-hydroxy-5-methoxy-3-oxopentanoate;5-oxabicyclo[2.1.1]hexane.
Molecular Properties
| Compound Name | ethyl 5-hydroxy-5-methoxy-3-oxopentanoate;5-oxabicyclo[2.1.1]hexane |
| PubChem CID | 21193727 |
| Molecular Formula | C13H22O6 |
| Molecular Weight | 274.31 g/mol |
| Exact Mass | 274.14 |
| IUPAC Name | ethyl 5-hydroxy-5-methoxy-3-oxopentanoate;5-oxabicyclo[2.1.1]hexane |
| SMILES | C1CC2CC1O2.CCOC(=O)CC(=O)CC(O)OC |
| InChI | InChI=1S/C8H14O5.C5H8O/c1-3-13-8(11)5-6(9)4-7(10)12-2;1-2-5-3-4(1)6-5/h7,10H,3-5H2,1-2H3;4-5H,1-3H2 |
| InChIKey | YPUJVKYNAJSNRP-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 274.31 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze ethyl 5-hydroxy-5-methoxy-3-oxopentanoate;5-oxabicyclo[2.1.1]hexane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 5-hydroxy-5-methoxy-3-oxopentanoate;5-oxabicyclo[2.1.1]hexane?
The IUPAC name of ethyl 5-hydroxy-5-methoxy-3-oxopentanoate;5-oxabicyclo[2.1.1]hexane (CID 21193727) is ethyl 5-hydroxy-5-methoxy-3-oxopentanoate;5-oxabicyclo[2.1.1]hexane.
What is the SMILES notation for ethyl 5-hydroxy-5-methoxy-3-oxopentanoate;5-oxabicyclo[2.1.1]hexane?
The canonical SMILES for ethyl 5-hydroxy-5-methoxy-3-oxopentanoate;5-oxabicyclo[2.1.1]hexane is C1CC2CC1O2.CCOC(=O)CC(=O)CC(O)OC.
What is the InChIKey of ethyl 5-hydroxy-5-methoxy-3-oxopentanoate;5-oxabicyclo[2.1.1]hexane?
The InChIKey is YPUJVKYNAJSNRP-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H14O5.C5H8O/c1-3-13-8(11)5-6(9)4-7(10)12-2;1-2-5-3-4(1)6-5/h7,10H,3-5H2,1-2H3;4-5H,1-3H2.
What are the key properties of ethyl 5-hydroxy-5-methoxy-3-oxopentanoate;5-oxabicyclo[2.1.1]hexane?
ethyl 5-hydroxy-5-methoxy-3-oxopentanoate;5-oxabicyclo[2.1.1]hexane has a molecular weight of 274.31 g/mol, XLogP of 0.80, 6 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 5-hydroxy-5-methoxy-3-oxopentanoate;5-oxabicyclo[2.1.1]hexane is sourced from PubChem (CID 21193727), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).