C23H40O — CID 21197472
4-methylidene-5,6-dioctylcyclohexa-1,5-dien-1-ol (PubChem CID 21197472) has the molecular formula C23H40O and a molecular weight of 332.57 g/mol. Its IUPAC name is 4-methylidene-5,6-dioctylcyclohexa-1,5-dien-1-ol.
| Compound Name | 4-methylidene-5,6-dioctylcyclohexa-1,5-dien-1-ol |
|---|---|
| PubChem CID | 21197472 |
| Molecular Formula | C23H40O |
| Molecular Weight | 332.57 g/mol |
| Exact Mass | 332.31 |
| IUPAC Name | 4-methylidene-5,6-dioctylcyclohexa-1,5-dien-1-ol |
| SMILES | C=C1CC=C(O)C(CCCCCCCC)=C1CCCCCCCC |
| InChI | InChI=1S/C23H40O/c1-4-6-8-10-12-14-16-21-20(3)18-19-23(24)22(21)17-15-13-11-9-7-5-2/h19,24H,3-18H2,1-2H3 |
| InChIKey | AXUANWKFHCWFME-UHFFFAOYSA-N |
| XLogP | 8.19 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.57 |
| LogP ≤ 5 | 8.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|