C26H36O2 — CID 90844568
2,5-bis(3-methylbut-2-enyl)-3,6-bis(3-methylbut-2-enylidene)cyclohexa-1,4-diene-1,4-diol (PubChem CID 90844568) has the molecular formula C26H36O2 and a molecular weight of 380.57 g/mol. Its IUPAC name is 2,5-bis(3-methylbut-2-enyl)-3,6-bis(3-methylbut-2-enylidene)cyclohexa-1,4-diene-1,4-diol.
| Compound Name | 2,5-bis(3-methylbut-2-enyl)-3,6-bis(3-methylbut-2-enylidene)cyclohexa-1,4-diene-1,4-diol |
|---|---|
| PubChem CID | 90844568 |
| Molecular Formula | C26H36O2 |
| Molecular Weight | 380.57 g/mol |
| Exact Mass | 380.27 |
| IUPAC Name | 2,5-bis(3-methylbut-2-enyl)-3,6-bis(3-methylbut-2-enylidene)cyclohexa-1,4-diene-1,4-diol |
| SMILES | CC(C)=CC=c1c(O)c(CC=C(C)C)c(=CC=C(C)C)c(O)c1CC=C(C)C |
| InChI | InChI=1S/C26H36O2/c1-17(2)9-13-21-22(14-10-18(3)4)26(28)24(16-12-20(7)8)23(25(21)27)15-11-19(5)6/h9-13,16,27-28H,14-15H2,1-8H3 |
| InChIKey | RZNUVFRPPJMQNG-UHFFFAOYSA-N |
| XLogP | 5.61 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.57 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|