C26H21F3N2O7 — CID 21198321
4-[[2-(5-cyano-2-phenylmethoxyphenoxy)-3,5,6-trifluoro-4-pyridinyl]oxy]-5-ethoxy-5-oxopentanoic acid (PubChem CID 21198321) has the molecular formula C26H21F3N2O7 and a molecular weight of 530.46 g/mol. Its IUPAC name is 4-[[2-(5-cyano-2-phenylmethoxyphenoxy)-3,5,6-trifluoro-4-pyridinyl]oxy]-5-ethoxy-5-oxopentanoic acid.
| Compound Name | 4-[[2-(5-cyano-2-phenylmethoxyphenoxy)-3,5,6-trifluoro-4-pyridinyl]oxy]-5-ethoxy-5-oxopentanoic acid |
|---|---|
| PubChem CID | 21198321 |
| Molecular Formula | C26H21F3N2O7 |
| Molecular Weight | 530.46 g/mol |
| Exact Mass | 530.13 |
| IUPAC Name | 4-[[2-(5-cyano-2-phenylmethoxyphenoxy)-3,5,6-trifluoro-4-pyridinyl]oxy]-5-ethoxy-5-oxopentanoic acid |
| SMILES | CCOC(=O)C(CCC(=O)O)Oc1c(F)c(F)nc(Oc2cc(C#N)ccc2OCc2ccccc2)c1F |
| InChI | InChI=1S/C26H21F3N2O7/c1-2-35-26(34)18(10-11-20(32)33)37-23-21(27)24(29)31-25(22(23)28)38-19-12-16(13-30)8-9-17(19)36-14-15-6-4-3-5-7-15/h3-9,12,18H,2,10-11,14H2,1H3,(H,32,33) |
| InChIKey | KCEAYRUUNPAONZ-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 127.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.46 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|