C26H24F3N3O5 — CID 21198422
ethyl 2-[[2-(5-cyano-2-phenylmethoxyphenoxy)-3,5,6-trifluoro-4-pyridinyl]-methylamino]-3-hydroxybutanoate (PubChem CID 21198422) has the molecular formula C26H24F3N3O5 and a molecular weight of 515.49 g/mol. Its IUPAC name is ethyl 2-[[2-(5-cyano-2-phenylmethoxyphenoxy)-3,5,6-trifluoro-4-pyridinyl]-methylamino]-3-hydroxybutanoate.
| Compound Name | ethyl 2-[[2-(5-cyano-2-phenylmethoxyphenoxy)-3,5,6-trifluoro-4-pyridinyl]-methylamino]-3-hydroxybutanoate |
|---|---|
| PubChem CID | 21198422 |
| Molecular Formula | C26H24F3N3O5 |
| Molecular Weight | 515.49 g/mol |
| Exact Mass | 515.17 |
| IUPAC Name | ethyl 2-[[2-(5-cyano-2-phenylmethoxyphenoxy)-3,5,6-trifluoro-4-pyridinyl]-methylamino]-3-hydroxybutanoate |
| SMILES | CCOC(=O)C(C(C)O)N(C)c1c(F)c(F)nc(Oc2cc(C#N)ccc2OCc2ccccc2)c1F |
| InChI | InChI=1S/C26H24F3N3O5/c1-4-35-26(34)22(15(2)33)32(3)23-20(27)24(29)31-25(21(23)28)37-19-12-17(13-30)10-11-18(19)36-14-16-8-6-5-7-9-16/h5-12,15,22,33H,4,14H2,1-3H3 |
| InChIKey | NUKQLMASTDSMQR-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 104.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.49 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|