C25H21F3N4O4 — CID 23441618
2-[4-[2-(5-cyano-2-phenylmethoxyphenoxy)-3,5,6-trifluoro-4-pyridinyl]piperazin-1-yl]acetic acid (PubChem CID 23441618) has the molecular formula C25H21F3N4O4 and a molecular weight of 498.46 g/mol. Its IUPAC name is 2-[4-[2-(5-cyano-2-phenylmethoxyphenoxy)-3,5,6-trifluoro-4-pyridinyl]piperazin-1-yl]acetic acid.
| Compound Name | 2-[4-[2-(5-cyano-2-phenylmethoxyphenoxy)-3,5,6-trifluoro-4-pyridinyl]piperazin-1-yl]acetic acid |
|---|---|
| PubChem CID | 23441618 |
| Molecular Formula | C25H21F3N4O4 |
| Molecular Weight | 498.46 g/mol |
| Exact Mass | 498.15 |
| IUPAC Name | 2-[4-[2-(5-cyano-2-phenylmethoxyphenoxy)-3,5,6-trifluoro-4-pyridinyl]piperazin-1-yl]acetic acid |
| SMILES | N#Cc1ccc(OCc2ccccc2)c(Oc2nc(F)c(F)c(N3CCN(CC(=O)O)CC3)c2F)c1 |
| InChI | InChI=1S/C25H21F3N4O4/c26-21-23(32-10-8-31(9-11-32)14-20(33)34)22(27)25(30-24(21)28)36-19-12-17(13-29)6-7-18(19)35-15-16-4-2-1-3-5-16/h1-7,12H,8-11,14-15H2,(H,33,34) |
| InChIKey | DRKYZYDJVHMCRN-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 98.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.46 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|