C32H20F4N2O2 — CID 21205042
N-[4-[4-[4-(benzylideneamino)phenoxy]-2,3,5,6-tetrafluorophenoxy]phenyl]-1-phenylmethanimine (PubChem CID 21205042) has the molecular formula C32H20F4N2O2 and a molecular weight of 540.52 g/mol. Its IUPAC name is N-[4-[4-[4-(benzylideneamino)phenoxy]-2,3,5,6-tetrafluorophenoxy]phenyl]-1-phenylmethanimine.
| Compound Name | N-[4-[4-[4-(benzylideneamino)phenoxy]-2,3,5,6-tetrafluorophenoxy]phenyl]-1-phenylmethanimine |
|---|---|
| PubChem CID | 21205042 |
| Molecular Formula | C32H20F4N2O2 |
| Molecular Weight | 540.52 g/mol |
| Exact Mass | 540.15 |
| IUPAC Name | N-[4-[4-[4-(benzylideneamino)phenoxy]-2,3,5,6-tetrafluorophenoxy]phenyl]-1-phenylmethanimine |
| SMILES | Fc1c(F)c(Oc2ccc(/N=C/c3ccccc3)cc2)c(F)c(F)c1Oc1ccc(/N=C/c2ccccc2)cc1 |
| InChI | InChI=1S/C32H20F4N2O2/c33-27-29(35)32(40-26-17-13-24(14-18-26)38-20-22-9-5-2-6-10-22)30(36)28(34)31(27)39-25-15-11-23(12-16-25)37-19-21-7-3-1-4-8-21/h1-20H/b37-19+,38-20+ |
| InChIKey | NZRNMAHBMRZLDE-RIOOQTRLSA-N |
| XLogP | 9.33 |
| TPSA | 43.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.52 |
| LogP ≤ 5 | 9.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|