C9H13N5O3 — CID 21212417
2-(1,3-dimethyl-2,6-dioxo-4,5-dihydropurin-9-yl)acetamide (PubChem CID 21212417) has the molecular formula C9H13N5O3 and a molecular weight of 239.24 g/mol. Its IUPAC name is 2-(1,3-dimethyl-2,6-dioxo-4,5-dihydropurin-9-yl)acetamide.
| Compound Name | 2-(1,3-dimethyl-2,6-dioxo-4,5-dihydropurin-9-yl)acetamide |
|---|---|
| PubChem CID | 21212417 |
| Molecular Formula | C9H13N5O3 |
| Molecular Weight | 239.24 g/mol |
| Exact Mass | 239.10 |
| IUPAC Name | 2-(1,3-dimethyl-2,6-dioxo-4,5-dihydropurin-9-yl)acetamide |
| SMILES | CN1C(=O)C2N=CN(CC(N)=O)C2N(C)C1=O |
| InChI | InChI=1S/C9H13N5O3/c1-12-7-6(8(16)13(2)9(12)17)11-4-14(7)3-5(10)15/h4,6-7H,3H2,1-2H3,(H2,10,15) |
| InChIKey | WAYKMDXCKDNGIB-UHFFFAOYSA-N |
| XLogP | -1.97 |
| TPSA | 99.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.24 |
| LogP ≤ 5 | -1.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |