C34H40FN5O — CID 21223776
N-[4-[4-[1-[(E)-but-2-enyl]benzimidazol-2-yl]-1,4-diazepan-1-yl]-2-(4-fluorophenyl)butyl]-N-methylbenzamide (PubChem CID 21223776) has the molecular formula C34H40FN5O and a molecular weight of 553.73 g/mol. Its IUPAC name is N-[4-[4-[1-[(E)-but-2-enyl]benzimidazol-2-yl]-1,4-diazepan-1-yl]-2-(4-fluorophenyl)butyl]-N-methylbenzamide.
| Compound Name | N-[4-[4-[1-[(E)-but-2-enyl]benzimidazol-2-yl]-1,4-diazepan-1-yl]-2-(4-fluorophenyl)butyl]-N-methylbenzamide |
|---|---|
| PubChem CID | 21223776 |
| Molecular Formula | C34H40FN5O |
| Molecular Weight | 553.73 g/mol |
| Exact Mass | 553.32 |
| IUPAC Name | N-[4-[4-[1-[(E)-but-2-enyl]benzimidazol-2-yl]-1,4-diazepan-1-yl]-2-(4-fluorophenyl)butyl]-N-methylbenzamide |
| SMILES | C/C=C/Cn1c(N2CCCN(CCC(CN(C)C(=O)c3ccccc3)c3ccc(F)cc3)CC2)nc2ccccc21 |
| InChI | InChI=1S/C34H40FN5O/c1-3-4-22-40-32-14-9-8-13-31(32)36-34(40)39-21-10-20-38(24-25-39)23-19-29(27-15-17-30(35)18-16-27)26-37(2)33(41)28-11-6-5-7-12-28/h3-9,11-18,29H,10,19-26H2,1-2H3/b4-3+ |
| InChIKey | GGVSVUZZLMQETM-ONEGZZNKSA-N |
| XLogP | 6.21 |
| TPSA | 44.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.73 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|