About 4H-triphenylen-1-one
4H-triphenylen-1-one (PubChem CID 21225631) has the molecular formula C18H12O
and a molecular weight of 244.29 g/mol. Its IUPAC name is 4H-triphenylen-1-one.
Molecular Properties
| Compound Name | 4H-triphenylen-1-one |
| PubChem CID | 21225631 |
| Molecular Formula | C18H12O |
| Molecular Weight | 244.29 g/mol |
| Exact Mass | 244.09 |
| IUPAC Name | 4H-triphenylen-1-one |
| SMILES | O=C1C=CCc2c1c1ccccc1c1ccccc21 |
| InChI | InChI=1S/C18H12O/c19-17-11-5-10-16-14-7-2-1-6-12(14)13-8-3-4-9-15(13)18(16)17/h1-9,11H,10H2 |
| InChIKey | WFVNKZATMJYHBT-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 244.29 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|
Analyze 4H-triphenylen-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4H-triphenylen-1-one?
The IUPAC name of 4H-triphenylen-1-one (CID 21225631) is 4H-triphenylen-1-one.
What is the SMILES notation for 4H-triphenylen-1-one?
The canonical SMILES for 4H-triphenylen-1-one is O=C1C=CCc2c1c1ccccc1c1ccccc21.
What is the InChIKey of 4H-triphenylen-1-one?
The InChIKey is WFVNKZATMJYHBT-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H12O/c19-17-11-5-10-16-14-7-2-1-6-12(14)13-8-3-4-9-15(13)18(16)17/h1-9,11H,10H2.
What are the key properties of 4H-triphenylen-1-one?
4H-triphenylen-1-one has a molecular weight of 244.29 g/mol, XLogP of 4.29, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4H-triphenylen-1-one is sourced from PubChem (CID 21225631), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).