C13H6O3S — CID 102259216
thioxanthene-1,4,9-trione (PubChem CID 102259216) has the molecular formula C13H6O3S and a molecular weight of 242.25 g/mol. Its IUPAC name is thioxanthene-1,4,9-trione.
| Compound Name | thioxanthene-1,4,9-trione |
|---|---|
| PubChem CID | 102259216 |
| Molecular Formula | C13H6O3S |
| Molecular Weight | 242.25 g/mol |
| Exact Mass | 242.00 |
| IUPAC Name | thioxanthene-1,4,9-trione |
| SMILES | O=C1C=CC(=O)c2c1sc1ccccc1c2=O |
| InChI | InChI=1S/C13H6O3S/c14-8-5-6-9(15)13-11(8)12(16)7-3-1-2-4-10(7)17-13/h1-6H |
| InChIKey | HBDQBZPLKGWWGT-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 51.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.25 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|