C12H12N6S — CID 21226849
12-ethylsulfanyl-8-methyl-1,8,10,11,13,14-hexazatetracyclo[7.6.0.02,7.011,15]pentadeca-2,4,6,9,12,14-hexaene (PubChem CID 21226849) has the molecular formula C12H12N6S and a molecular weight of 272.34 g/mol. Its IUPAC name is 12-ethylsulfanyl-8-methyl-1,8,10,11,13,14-hexazatetracyclo[7.6.0.02,7.011,15]pentadeca-2,4,6,9,12,14-hexaene.
| Compound Name | 12-ethylsulfanyl-8-methyl-1,8,10,11,13,14-hexazatetracyclo[7.6.0.02,7.011,15]pentadeca-2,4,6,9,12,14-hexaene |
|---|---|
| PubChem CID | 21226849 |
| Molecular Formula | C12H12N6S |
| Molecular Weight | 272.34 g/mol |
| Exact Mass | 272.08 |
| IUPAC Name | 12-ethylsulfanyl-8-methyl-1,8,10,11,13,14-hexazatetracyclo[7.6.0.02,7.011,15]pentadeca-2,4,6,9,12,14-hexaene |
| SMILES | CCSc1nnc2n1nc1n(C)c3ccccc3n12 |
| InChI | InChI=1S/C12H12N6S/c1-3-19-12-14-13-10-17-9-7-5-4-6-8(9)16(2)11(17)15-18(10)12/h4-7H,3H2,1-2H3 |
| InChIKey | GAUCOTFVECKQPT-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 52.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.34 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |