C27H26N2O5S — CID 21227885
methyl 4-[[(5Z)-5-[(2,7-diethoxynaphthalen-1-yl)methylidene]-3-methyl-4-oxo-1,3-thiazolidin-2-ylidene]amino]benzoate (PubChem CID 21227885) has the molecular formula C27H26N2O5S and a molecular weight of 490.58 g/mol. Its IUPAC name is methyl 4-[[(5Z)-5-[(2,7-diethoxynaphthalen-1-yl)methylidene]-3-methyl-4-oxo-1,3-thiazolidin-2-ylidene]amino]benzoate.
| Compound Name | methyl 4-[[(5Z)-5-[(2,7-diethoxynaphthalen-1-yl)methylidene]-3-methyl-4-oxo-1,3-thiazolidin-2-ylidene]amino]benzoate |
|---|---|
| PubChem CID | 21227885 |
| Molecular Formula | C27H26N2O5S |
| Molecular Weight | 490.58 g/mol |
| Exact Mass | 490.16 |
| IUPAC Name | methyl 4-[[(5Z)-5-[(2,7-diethoxynaphthalen-1-yl)methylidene]-3-methyl-4-oxo-1,3-thiazolidin-2-ylidene]amino]benzoate |
| SMILES | CCOc1ccc2ccc(OCC)c(/C=C3\S/C(=N/c4ccc(C(=O)OC)cc4)N(C)C3=O)c2c1 |
| InChI | InChI=1S/C27H26N2O5S/c1-5-33-20-13-9-17-10-14-23(34-6-2)22(21(17)15-20)16-24-25(30)29(3)27(35-24)28-19-11-7-18(8-12-19)26(31)32-4/h7-16H,5-6H2,1-4H3/b24-16-,28-27+ |
| InChIKey | DAQRPPRQPHORQS-USPLRNBBSA-N |
| XLogP | 5.66 |
| TPSA | 77.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.58 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|