C11H13N5O — CID 21230448
3-N-[(E)-1-phenylpropan-2-ylideneamino]-1,2,5-oxadiazole-3,4-diamine (PubChem CID 21230448) has the molecular formula C11H13N5O and a molecular weight of 231.26 g/mol. Its IUPAC name is 3-N-[(E)-1-phenylpropan-2-ylideneamino]-1,2,5-oxadiazole-3,4-diamine.
| Compound Name | 3-N-[(E)-1-phenylpropan-2-ylideneamino]-1,2,5-oxadiazole-3,4-diamine |
|---|---|
| PubChem CID | 21230448 |
| Molecular Formula | C11H13N5O |
| Molecular Weight | 231.26 g/mol |
| Exact Mass | 231.11 |
| IUPAC Name | 3-N-[(E)-1-phenylpropan-2-ylideneamino]-1,2,5-oxadiazole-3,4-diamine |
| SMILES | C/C(Cc1ccccc1)=N\Nc1nonc1N |
| InChI | InChI=1S/C11H13N5O/c1-8(7-9-5-3-2-4-6-9)13-14-11-10(12)15-17-16-11/h2-6H,7H2,1H3,(H2,12,15)(H,14,16)/b13-8+ |
| InChIKey | QJMUWQFIIPVRPT-MDWZMJQESA-N |
| XLogP | 1.68 |
| TPSA | 89.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.26 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|