C16H13ClN4O3 — CID 21230853
N-[(E)-N'-(1,3-benzoxazol-2-yl)carbamimidoyl]-2-(4-chlorophenoxy)acetamide (PubChem CID 21230853) has the molecular formula C16H13ClN4O3 and a molecular weight of 344.76 g/mol. Its IUPAC name is N-[(E)-N'-(1,3-benzoxazol-2-yl)carbamimidoyl]-2-(4-chlorophenoxy)acetamide.
| Compound Name | N-[(E)-N'-(1,3-benzoxazol-2-yl)carbamimidoyl]-2-(4-chlorophenoxy)acetamide |
|---|---|
| PubChem CID | 21230853 |
| Molecular Formula | C16H13ClN4O3 |
| Molecular Weight | 344.76 g/mol |
| Exact Mass | 344.07 |
| IUPAC Name | N-[(E)-N'-(1,3-benzoxazol-2-yl)carbamimidoyl]-2-(4-chlorophenoxy)acetamide |
| SMILES | N/C(=N\c1nc2ccccc2o1)NC(=O)COc1ccc(Cl)cc1 |
| InChI | InChI=1S/C16H13ClN4O3/c17-10-5-7-11(8-6-10)23-9-14(22)20-15(18)21-16-19-12-3-1-2-4-13(12)24-16/h1-8H,9H2,(H3,18,19,20,21,22) |
| InChIKey | FBHHCKBEOVGOSL-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 102.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.76 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|