C18H18N4O2 — CID 86232361
N-[N'-(1,3-benzoxazol-2-yl)carbamimidoyl]-4-phenylbutanamide (PubChem CID 86232361) has the molecular formula C18H18N4O2 and a molecular weight of 322.37 g/mol. Its IUPAC name is N-[N'-(1,3-benzoxazol-2-yl)carbamimidoyl]-4-phenylbutanamide.
| Compound Name | N-[N'-(1,3-benzoxazol-2-yl)carbamimidoyl]-4-phenylbutanamide |
|---|---|
| PubChem CID | 86232361 |
| Molecular Formula | C18H18N4O2 |
| Molecular Weight | 322.37 g/mol |
| Exact Mass | 322.14 |
| IUPAC Name | N-[N'-(1,3-benzoxazol-2-yl)carbamimidoyl]-4-phenylbutanamide |
| SMILES | NC(=Nc1nc2ccccc2o1)NC(=O)CCCc1ccccc1 |
| InChI | InChI=1S/C18H18N4O2/c19-17(22-18-20-14-10-4-5-11-15(14)24-18)21-16(23)12-6-9-13-7-2-1-3-8-13/h1-5,7-8,10-11H,6,9,12H2,(H3,19,20,21,22,23) |
| InChIKey | ZZWTXQORHIBLBB-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 93.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.37 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|