About N-(N'-cyclohexa-1,5-dien-3-yn-1-ylcarbamimidoyl)-3-phenylpropanamide
N-(N'-cyclohexa-1,5-dien-3-yn-1-ylcarbamimidoyl)-3-phenylpropanamide (PubChem CID 166876286) has the molecular formula C16H15N3O
and a molecular weight of 265.32 g/mol. Its IUPAC name is N-(N'-cyclohexa-1,5-dien-3-yn-1-ylcarbamimidoyl)-3-phenylpropanamide.
Molecular Properties
| Compound Name | N-(N'-cyclohexa-1,5-dien-3-yn-1-ylcarbamimidoyl)-3-phenylpropanamide |
| PubChem CID | 166876286 |
| Molecular Formula | C16H15N3O |
| Molecular Weight | 265.32 g/mol |
| Exact Mass | 265.12 |
| IUPAC Name | N-(N'-cyclohexa-1,5-dien-3-yn-1-ylcarbamimidoyl)-3-phenylpropanamide |
| SMILES | N/C(=N\c1cc#ccc1)NC(=O)CCc1ccccc1 |
| InChI | InChI=1S/C16H15N3O/c17-16(18-14-9-5-2-6-10-14)19-15(20)12-11-13-7-3-1-4-8-13/h1,3-5,7-10H,11-12H2,(H3,17,18,19,20) |
| InChIKey | SAEIQAYQRULHLK-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 67.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 265.32 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze N-(N'-cyclohexa-1,5-dien-3-yn-1-ylcarbamimidoyl)-3-phenylpropanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(N'-cyclohexa-1,5-dien-3-yn-1-ylcarbamimidoyl)-3-phenylpropanamide?
The IUPAC name of N-(N'-cyclohexa-1,5-dien-3-yn-1-ylcarbamimidoyl)-3-phenylpropanamide (CID 166876286) is N-(N'-cyclohexa-1,5-dien-3-yn-1-ylcarbamimidoyl)-3-phenylpropanamide.
What is the SMILES notation for N-(N'-cyclohexa-1,5-dien-3-yn-1-ylcarbamimidoyl)-3-phenylpropanamide?
The canonical SMILES for N-(N'-cyclohexa-1,5-dien-3-yn-1-ylcarbamimidoyl)-3-phenylpropanamide is N/C(=N\c1cc#ccc1)NC(=O)CCc1ccccc1.
What is the InChIKey of N-(N'-cyclohexa-1,5-dien-3-yn-1-ylcarbamimidoyl)-3-phenylpropanamide?
The InChIKey is SAEIQAYQRULHLK-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H15N3O/c17-16(18-14-9-5-2-6-10-14)19-15(20)12-11-13-7-3-1-4-8-13/h1,3-5,7-10H,11-12H2,(H3,17,18,19,20).
What are the key properties of N-(N'-cyclohexa-1,5-dien-3-yn-1-ylcarbamimidoyl)-3-phenylpropanamide?
N-(N'-cyclohexa-1,5-dien-3-yn-1-ylcarbamimidoyl)-3-phenylpropanamide has a molecular weight of 265.32 g/mol, XLogP of 1.98, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-(N'-cyclohexa-1,5-dien-3-yn-1-ylcarbamimidoyl)-3-phenylpropanamide is sourced from PubChem (CID 166876286), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).