C20H24N4O2 — CID 143519913
N-[(E)-N'-(1,3-benzoxazol-2-yl)carbamimidoyl]formamide;cyclopropylbenzene;ethane (PubChem CID 143519913) has the molecular formula C20H24N4O2 and a molecular weight of 352.44 g/mol. Its IUPAC name is N-[(E)-N'-(1,3-benzoxazol-2-yl)carbamimidoyl]formamide;cyclopropylbenzene;ethane.
| Compound Name | N-[(E)-N'-(1,3-benzoxazol-2-yl)carbamimidoyl]formamide;cyclopropylbenzene;ethane |
|---|---|
| PubChem CID | 143519913 |
| Molecular Formula | C20H24N4O2 |
| Molecular Weight | 352.44 g/mol |
| Exact Mass | 352.19 |
| IUPAC Name | N-[(E)-N'-(1,3-benzoxazol-2-yl)carbamimidoyl]formamide;cyclopropylbenzene;ethane |
| SMILES | CC.N/C(=N\c1nc2ccccc2o1)NC=O.c1ccc(C2CC2)cc1 |
| InChI | InChI=1S/C9H8N4O2.C9H10.C2H6/c10-8(11-5-14)13-9-12-6-3-1-2-4-7(6)15-9;1-2-4-8(5-3-1)9-6-7-9;1-2/h1-5H,(H3,10,11,12,13,14);1-5,9H,6-7H2;1-2H3 |
| InChIKey | FHJWSBJCQQKOFM-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 93.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.44 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|