C12H11FN4O2 — CID 70927603
trans-(1R,2S)-N-[N'-(1,3-benzoxazol-2-yl)carbamimidoyl]-2-fluorocyclopropane-1-carboxamide (PubChem CID 70927603) has the molecular formula C12H11FN4O2 and a molecular weight of 262.24 g/mol. Its IUPAC name is trans-(1R,2S)-N-[N'-(1,3-benzoxazol-2-yl)carbamimidoyl]-2-fluorocyclopropane-1-carboxamide.
| Compound Name | trans-(1R,2S)-N-[N'-(1,3-benzoxazol-2-yl)carbamimidoyl]-2-fluorocyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 70927603 |
| Molecular Formula | C12H11FN4O2 |
| Molecular Weight | 262.24 g/mol |
| Exact Mass | 262.09 |
| IUPAC Name | trans-(1R,2S)-N-[N'-(1,3-benzoxazol-2-yl)carbamimidoyl]-2-fluorocyclopropane-1-carboxamide |
| SMILES | NC(=Nc1nc2ccccc2o1)NC(=O)[C@H]1C[C@@H]1F |
| InChI | InChI=1S/C12H11FN4O2/c13-7-5-6(7)10(18)16-11(14)17-12-15-8-3-1-2-4-9(8)19-12/h1-4,6-7H,5H2,(H3,14,15,16,17,18)/t6-,7-/m0/s1 |
| InChIKey | JQUGTUINKKEGBQ-BQBZGAKWSA-N |
| XLogP | 1.25 |
| TPSA | 93.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.24 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|