C10H13N3 — CID 2123179
N-(pyridin-4-ylmethyl)-3,4-dihydro-2H-pyrrol-5-amine (PubChem CID 2123179) has the molecular formula C10H13N3 and a molecular weight of 175.24 g/mol. Its IUPAC name is N-(pyridin-4-ylmethyl)-3,4-dihydro-2H-pyrrol-5-amine.
| Compound Name | N-(pyridin-4-ylmethyl)-3,4-dihydro-2H-pyrrol-5-amine |
|---|---|
| PubChem CID | 2123179 |
| Molecular Formula | C10H13N3 |
| Molecular Weight | 175.24 g/mol |
| Exact Mass | 175.11 |
| IUPAC Name | N-(pyridin-4-ylmethyl)-3,4-dihydro-2H-pyrrol-5-amine |
| SMILES | c1cc(CNC2=NCCC2)ccn1 |
| InChI | InChI=1S/C10H13N3/c1-2-10(12-5-1)13-8-9-3-6-11-7-4-9/h3-4,6-7H,1-2,5,8H2,(H,12,13) |
| InChIKey | YFXBHNMOSMFBPP-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 37.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 175.24 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |