C11H15N3 — CID 79508326
N-(2-pyridin-2-ylethyl)-3,4-dihydro-2H-pyrrol-5-amine (PubChem CID 79508326) has the molecular formula C11H15N3 and a molecular weight of 189.26 g/mol. Its IUPAC name is N-(2-pyridin-2-ylethyl)-3,4-dihydro-2H-pyrrol-5-amine.
| Compound Name | N-(2-pyridin-2-ylethyl)-3,4-dihydro-2H-pyrrol-5-amine |
|---|---|
| PubChem CID | 79508326 |
| Molecular Formula | C11H15N3 |
| Molecular Weight | 189.26 g/mol |
| Exact Mass | 189.13 |
| IUPAC Name | N-(2-pyridin-2-ylethyl)-3,4-dihydro-2H-pyrrol-5-amine |
| SMILES | c1ccc(CCNC2=NCCC2)nc1 |
| InChI | InChI=1S/C11H15N3/c1-2-7-12-10(4-1)6-9-14-11-5-3-8-13-11/h1-2,4,7H,3,5-6,8-9H2,(H,13,14) |
| InChIKey | ZHVQHSYJCMPKHM-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 37.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.26 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |