C18H30N2O2 — CID 21238371
2,5-bis(hexylamino)cyclohexa-2,5-diene-1,4-dione (PubChem CID 21238371) has the molecular formula C18H30N2O2 and a molecular weight of 306.45 g/mol. Its IUPAC name is 2,5-bis(hexylamino)cyclohexa-2,5-diene-1,4-dione.
| Compound Name | 2,5-bis(hexylamino)cyclohexa-2,5-diene-1,4-dione |
|---|---|
| PubChem CID | 21238371 |
| Molecular Formula | C18H30N2O2 |
| Molecular Weight | 306.45 g/mol |
| Exact Mass | 306.23 |
| IUPAC Name | 2,5-bis(hexylamino)cyclohexa-2,5-diene-1,4-dione |
| SMILES | CCCCCCNC1=CC(=O)C(NCCCCCC)=CC1=O |
| InChI | InChI=1S/C18H30N2O2/c1-3-5-7-9-11-19-15-13-18(22)16(14-17(15)21)20-12-10-8-6-4-2/h13-14,19-20H,3-12H2,1-2H3 |
| InChIKey | STJSBQDBJLFHOJ-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.45 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'} |
|---|