C15H25N3O2 — CID 3063568
2-[4-(diethylamino)butylamino]-5-(methylamino)cyclohexa-2,5-diene-1,4-dione (PubChem CID 3063568) has the molecular formula C15H25N3O2 and a molecular weight of 279.38 g/mol. Its IUPAC name is 2-[4-(diethylamino)butylamino]-5-(methylamino)cyclohexa-2,5-diene-1,4-dione.
| Compound Name | 2-[4-(diethylamino)butylamino]-5-(methylamino)cyclohexa-2,5-diene-1,4-dione |
|---|---|
| PubChem CID | 3063568 |
| Molecular Formula | C15H25N3O2 |
| Molecular Weight | 279.38 g/mol |
| Exact Mass | 279.19 |
| IUPAC Name | 2-[4-(diethylamino)butylamino]-5-(methylamino)cyclohexa-2,5-diene-1,4-dione |
| SMILES | CCN(CC)CCCCNC1=CC(=O)C(NC)=CC1=O |
| InChI | InChI=1S/C15H25N3O2/c1-4-18(5-2)9-7-6-8-17-13-11-14(19)12(16-3)10-15(13)20/h10-11,16-17H,4-9H2,1-3H3 |
| InChIKey | FSLBHKJXVCYFJY-UHFFFAOYSA-N |
| XLogP | 0.84 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.38 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'} |
|---|