About 3-piperidin-1-ylpropyl (1E)-2-chloro-N-hydroxybenzenecarboximidothioate chloride
3-piperidin-1-ylpropyl (1E)-2-chloro-N-hydroxybenzenecarboximidothioate chloride (PubChem CID 21238809) has the molecular formula C15H21Cl2N2OS-
and a molecular weight of 348.32 g/mol. Its IUPAC name is 3-piperidin-1-ylpropyl (1E)-2-chloro-N-hydroxybenzenecarboximidothioate chloride.
Molecular Properties
| Compound Name | 3-piperidin-1-ylpropyl (1E)-2-chloro-N-hydroxybenzenecarboximidothioate chloride |
| PubChem CID | 21238809 |
| Molecular Formula | C15H21Cl2N2OS- |
| Molecular Weight | 348.32 g/mol |
| Exact Mass | 347.08 |
| IUPAC Name | 3-piperidin-1-ylpropyl (1E)-2-chloro-N-hydroxybenzenecarboximidothioate chloride |
| SMILES | O/N=C(/SCCCN1CCCCC1)c1ccccc1Cl.[Cl-] |
| InChI | InChI=1S/C15H21ClN2OS.ClH/c16-14-8-3-2-7-13(14)15(17-19)20-12-6-11-18-9-4-1-5-10-18;/h2-3,7-8,19H,1,4-6,9-12H2;1H/p-1/b17-15+; |
| InChIKey | MEBVADFLSLVNIB-INTLEYBYSA-M |
| XLogP | 1.09 |
| TPSA | 35.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 348.32 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 3-piperidin-1-ylpropyl (1E)-2-chloro-N-hydroxybenzenecarboximidothioate chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-piperidin-1-ylpropyl (1E)-2-chloro-N-hydroxybenzenecarboximidothioate chloride?
The IUPAC name of 3-piperidin-1-ylpropyl (1E)-2-chloro-N-hydroxybenzenecarboximidothioate chloride (CID 21238809) is 3-piperidin-1-ylpropyl (1E)-2-chloro-N-hydroxybenzenecarboximidothioate chloride.
What is the SMILES notation for 3-piperidin-1-ylpropyl (1E)-2-chloro-N-hydroxybenzenecarboximidothioate chloride?
The canonical SMILES for 3-piperidin-1-ylpropyl (1E)-2-chloro-N-hydroxybenzenecarboximidothioate chloride is O/N=C(/SCCCN1CCCCC1)c1ccccc1Cl.[Cl-].
What is the InChIKey of 3-piperidin-1-ylpropyl (1E)-2-chloro-N-hydroxybenzenecarboximidothioate chloride?
The InChIKey is MEBVADFLSLVNIB-INTLEYBYSA-M. The full InChI is InChI=1S/C15H21ClN2OS.ClH/c16-14-8-3-2-7-13(14)15(17-19)20-12-6-11-18-9-4-1-5-10-18;/h2-3,7-8,19H,1,4-6,9-12H2;1H/p-1/b17-15+;.
What are the key properties of 3-piperidin-1-ylpropyl (1E)-2-chloro-N-hydroxybenzenecarboximidothioate chloride?
3-piperidin-1-ylpropyl (1E)-2-chloro-N-hydroxybenzenecarboximidothioate chloride has a molecular weight of 348.32 g/mol, XLogP of 1.09, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-piperidin-1-ylpropyl (1E)-2-chloro-N-hydroxybenzenecarboximidothioate chloride is sourced from PubChem (CID 21238809), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).